About 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine
5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine (PubChem CID 142601933) has the molecular formula C12H14BCl2NO2
and a molecular weight of 285.97 g/mol. Its IUPAC name is 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine.
Molecular Properties
| Compound Name | 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine |
| PubChem CID | 142601933 |
| Molecular Formula | C12H14BCl2NO2 |
| Molecular Weight | 285.97 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine |
| SMILES | OB1OCc2cc(Cl)c(NCC3CCC3)c(Cl)c21 |
| InChI | InChI=1S/C12H14BCl2NO2/c14-9-4-8-6-18-13(17)10(8)11(15)12(9)16-5-7-2-1-3-7/h4,7,16-17H,1-3,5-6H2 |
| InChIKey | ZQSHYANTFMMSJP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.97 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine?
The IUPAC name of 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine (CID 142601933) is 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine.
What is the SMILES notation for 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine?
The canonical SMILES for 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine is OB1OCc2cc(Cl)c(NCC3CCC3)c(Cl)c21.
What is the InChIKey of 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine?
The InChIKey is ZQSHYANTFMMSJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BCl2NO2/c14-9-4-8-6-18-13(17)10(8)11(15)12(9)16-5-7-2-1-3-7/h4,7,16-17H,1-3,5-6H2.
What are the key properties of 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine?
5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine has a molecular weight of 285.97 g/mol, XLogP of 2.42, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine is sourced from PubChem (CID 142601933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).