C12H14BCl2NO2 — CID 142601933
5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine (PubChem CID 142601933) has the molecular formula C12H14BCl2NO2 and a molecular weight of 285.97 g/mol. Its IUPAC name is 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine.
| Compound Name | 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine |
|---|---|
| PubChem CID | 142601933 |
| Molecular Formula | C12H14BCl2NO2 |
| Molecular Weight | 285.97 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 5,7-dichloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine |
| SMILES | OB1OCc2cc(Cl)c(NCC3CCC3)c(Cl)c21 |
| InChI | InChI=1S/C12H14BCl2NO2/c14-9-4-8-6-18-13(17)10(8)11(15)12(9)16-5-7-2-1-3-7/h4,7,16-17H,1-3,5-6H2 |
| InChIKey | ZQSHYANTFMMSJP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.97 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|