C17H22BCl2NO4 — CID 142601995
tert-butyl N-(cyclobutylmethyl)-N-(5,7-dichloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate (PubChem CID 142601995) has the molecular formula C17H22BCl2NO4 and a molecular weight of 386.08 g/mol. Its IUPAC name is tert-butyl N-(cyclobutylmethyl)-N-(5,7-dichloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate.
| Compound Name | tert-butyl N-(cyclobutylmethyl)-N-(5,7-dichloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate |
|---|---|
| PubChem CID | 142601995 |
| Molecular Formula | C17H22BCl2NO4 |
| Molecular Weight | 386.08 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | tert-butyl N-(cyclobutylmethyl)-N-(5,7-dichloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC1CCC1)c1c(Cl)cc2c(c1Cl)B(O)OC2 |
| InChI | InChI=1S/C17H22BCl2NO4/c1-17(2,3)25-16(22)21(8-10-5-4-6-10)15-12(19)7-11-9-24-18(23)13(11)14(15)20/h7,10,23H,4-6,8-9H2,1-3H3 |
| InChIKey | TXTZTRAAOCTNQQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.08 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|