C11H10BClO5 — CID 140761947
2-oxopropyl 5-chloro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate (PubChem CID 140761947) has the molecular formula C11H10BClO5 and a molecular weight of 268.46 g/mol. Its IUPAC name is 2-oxopropyl 5-chloro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate.
| Compound Name | 2-oxopropyl 5-chloro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate |
|---|---|
| PubChem CID | 140761947 |
| Molecular Formula | C11H10BClO5 |
| Molecular Weight | 268.46 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-oxopropyl 5-chloro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate |
| SMILES | CC(=O)COC(=O)c1cc2c(cc1Cl)COB2O |
| InChI | InChI=1S/C11H10BClO5/c1-6(14)4-17-11(15)8-3-9-7(2-10(8)13)5-18-12(9)16/h2-3,16H,4-5H2,1H3 |
| InChIKey | FFTOJGPXSVZBJR-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.46 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|