C11H12BClO6S2 — CID 153095584
5-chloro-1-hydroxy-6-(4-sulfosulfanylbutanoyl)-3H-2,1-benzoxaborole (PubChem CID 153095584) has the molecular formula C11H12BClO6S2 and a molecular weight of 350.61 g/mol. Its IUPAC name is 5-chloro-1-hydroxy-6-(4-sulfosulfanylbutanoyl)-3H-2,1-benzoxaborole.
| Compound Name | 5-chloro-1-hydroxy-6-(4-sulfosulfanylbutanoyl)-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 153095584 |
| Molecular Formula | C11H12BClO6S2 |
| Molecular Weight | 350.61 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 5-chloro-1-hydroxy-6-(4-sulfosulfanylbutanoyl)-3H-2,1-benzoxaborole |
| SMILES | O=C(CCCSS(=O)(=O)O)c1cc2c(cc1Cl)COB2O |
| InChI | InChI=1S/C11H12BClO6S2/c13-10-4-7-6-19-12(15)9(7)5-8(10)11(14)2-1-3-20-21(16,17)18/h4-5,15H,1-3,6H2,(H,16,17,18) |
| InChIKey | VQARJFBKVPCVHI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.61 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|