C18H14BClN2O3 — CID 147130342
1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-(3-phenyl-1H-pyrazol-5-yl)ethanone (PubChem CID 147130342) has the molecular formula C18H14BClN2O3 and a molecular weight of 352.59 g/mol. Its IUPAC name is 1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-(3-phenyl-1H-pyrazol-5-yl)ethanone.
| Compound Name | 1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-(3-phenyl-1H-pyrazol-5-yl)ethanone |
|---|---|
| PubChem CID | 147130342 |
| Molecular Formula | C18H14BClN2O3 |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-(3-phenyl-1H-pyrazol-5-yl)ethanone |
| SMILES | O=C(Cc1cc(-c2ccccc2)n[nH]1)c1cc2c(cc1Cl)COB2O |
| InChI | InChI=1S/C18H14BClN2O3/c20-16-6-12-10-25-19(24)15(12)9-14(16)18(23)8-13-7-17(22-21-13)11-4-2-1-3-5-11/h1-7,9,24H,8,10H2,(H,21,22) |
| InChIKey | BQCBLQFTWFGTJD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|