C19H16BClN2O3 — CID 159592382
1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-(4-pyrazol-1-ylphenyl)propan-1-one (PubChem CID 159592382) has the molecular formula C19H16BClN2O3 and a molecular weight of 366.61 g/mol. Its IUPAC name is 1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-(4-pyrazol-1-ylphenyl)propan-1-one.
| Compound Name | 1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-(4-pyrazol-1-ylphenyl)propan-1-one |
|---|---|
| PubChem CID | 159592382 |
| Molecular Formula | C19H16BClN2O3 |
| Molecular Weight | 366.61 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-(4-pyrazol-1-ylphenyl)propan-1-one |
| SMILES | O=C(CCc1ccc(-n2cccn2)cc1)c1cc2c(cc1Cl)COB2O |
| InChI | InChI=1S/C19H16BClN2O3/c21-18-10-14-12-26-20(25)17(14)11-16(18)19(24)7-4-13-2-5-15(6-3-13)23-9-1-8-22-23/h1-3,5-6,8-11,25H,4,7,12H2 |
| InChIKey | MKKDXOBKBVWJDP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.61 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|