C11H12ClNO5S — CID 7975114
2-oxopropyl 2-chloro-5-(methylsulfamoyl)benzoate (PubChem CID 7975114) has the molecular formula C11H12ClNO5S and a molecular weight of 305.74 g/mol. Its IUPAC name is 2-oxopropyl 2-chloro-5-(methylsulfamoyl)benzoate.
| Compound Name | 2-oxopropyl 2-chloro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7975114 |
| Molecular Formula | C11H12ClNO5S |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 2-oxopropyl 2-chloro-5-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(C(=O)OCC(C)=O)c1 |
| InChI | InChI=1S/C11H12ClNO5S/c1-7(14)6-18-11(15)9-5-8(3-4-10(9)12)19(16,17)13-2/h3-5,13H,6H2,1-2H3 |
| InChIKey | UHFSVYIKQHRPGU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |