C16H14BrClN2O5S — CID 42963968
[2-(methylamino)-2-oxoethyl] 5-[(4-bromophenyl)sulfamoyl]-2-chlorobenzoate (PubChem CID 42963968) has the molecular formula C16H14BrClN2O5S and a molecular weight of 461.72 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 5-[(4-bromophenyl)sulfamoyl]-2-chlorobenzoate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 5-[(4-bromophenyl)sulfamoyl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 42963968 |
| Molecular Formula | C16H14BrClN2O5S |
| Molecular Weight | 461.72 g/mol |
| Exact Mass | 459.95 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 5-[(4-bromophenyl)sulfamoyl]-2-chlorobenzoate |
| SMILES | CNC(=O)COC(=O)c1cc(S(=O)(=O)Nc2ccc(Br)cc2)ccc1Cl |
| InChI | InChI=1S/C16H14BrClN2O5S/c1-19-15(21)9-25-16(22)13-8-12(6-7-14(13)18)26(23,24)20-11-4-2-10(17)3-5-11/h2-8,20H,9H2,1H3,(H,19,21) |
| InChIKey | YMHDALOYZXETDT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.72 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |