C11H10BCl2NO3 — CID 91810813
(E)-1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-N-(2-chloroprop-2-enoxy)methanimine (PubChem CID 91810813) has the molecular formula C11H10BCl2NO3 and a molecular weight of 285.92 g/mol. Its IUPAC name is (E)-1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-N-(2-chloroprop-2-enoxy)methanimine.
| Compound Name | (E)-1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-N-(2-chloroprop-2-enoxy)methanimine |
|---|---|
| PubChem CID | 91810813 |
| Molecular Formula | C11H10BCl2NO3 |
| Molecular Weight | 285.92 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | (E)-1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-N-(2-chloroprop-2-enoxy)methanimine |
| SMILES | C=C(Cl)CO/N=C/c1cc2c(cc1Cl)COB2O |
| InChI | InChI=1S/C11H10BCl2NO3/c1-7(13)5-18-15-4-8-2-10-9(3-11(8)14)6-17-12(10)16/h2-4,16H,1,5-6H2/b15-4+ |
| InChIKey | ACILVULFNXIWPQ-SYZQJQIISA-N |
| XLogP | 1.66 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.92 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|