C16H12BFO5 — CID 140761746
phenacyl 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate (PubChem CID 140761746) has the molecular formula C16H12BFO5 and a molecular weight of 314.08 g/mol. Its IUPAC name is phenacyl 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate.
| Compound Name | phenacyl 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate |
|---|---|
| PubChem CID | 140761746 |
| Molecular Formula | C16H12BFO5 |
| Molecular Weight | 314.08 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | phenacyl 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate |
| SMILES | O=C(COC(=O)c1cc2c(cc1F)COB2O)c1ccccc1 |
| InChI | InChI=1S/C16H12BFO5/c18-14-6-11-8-23-17(21)13(11)7-12(14)16(20)22-9-15(19)10-4-2-1-3-5-10/h1-7,21H,8-9H2 |
| InChIKey | QGJRZROIQHZTTC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.08 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|