C16H13BClFO3 — CID 160858312
1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-(2-fluorophenyl)propan-1-one (PubChem CID 160858312) has the molecular formula C16H13BClFO3 and a molecular weight of 318.54 g/mol. Its IUPAC name is 1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-(2-fluorophenyl)propan-1-one.
| Compound Name | 1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-(2-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 160858312 |
| Molecular Formula | C16H13BClFO3 |
| Molecular Weight | 318.54 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-(2-fluorophenyl)propan-1-one |
| SMILES | O=C(CCc1ccccc1F)c1cc2c(cc1Cl)COB2O |
| InChI | InChI=1S/C16H13BClFO3/c18-14-7-11-9-22-17(21)13(11)8-12(14)16(20)6-5-10-3-1-2-4-15(10)19/h1-4,7-8,21H,5-6,9H2 |
| InChIKey | SKDQYBMCAZOYTN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.54 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|