C22H16BFO4 — CID 148936944
2-(2-benzoylphenyl)-1-(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone (PubChem CID 148936944) has the molecular formula C22H16BFO4 and a molecular weight of 374.18 g/mol. Its IUPAC name is 2-(2-benzoylphenyl)-1-(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone.
| Compound Name | 2-(2-benzoylphenyl)-1-(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone |
|---|---|
| PubChem CID | 148936944 |
| Molecular Formula | C22H16BFO4 |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-(2-benzoylphenyl)-1-(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone |
| SMILES | O=C(Cc1ccccc1C(=O)c1ccccc1)c1cc2c(cc1F)COB2O |
| InChI | InChI=1S/C22H16BFO4/c24-20-10-16-13-28-23(27)19(16)12-18(20)21(25)11-15-8-4-5-9-17(15)22(26)14-6-2-1-3-7-14/h1-10,12,27H,11,13H2 |
| InChIKey | PNDGWAOYBWAGJY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|