C17H16BFO5 — CID 67568864
ethyl 5-fluoro-4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-methylbenzoate (PubChem CID 67568864) has the molecular formula C17H16BFO5 and a molecular weight of 330.12 g/mol. Its IUPAC name is ethyl 5-fluoro-4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-methylbenzoate.
| Compound Name | ethyl 5-fluoro-4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-methylbenzoate |
|---|---|
| PubChem CID | 67568864 |
| Molecular Formula | C17H16BFO5 |
| Molecular Weight | 330.12 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | ethyl 5-fluoro-4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-methylbenzoate |
| SMILES | CCOC(=O)c1cc(F)c(Oc2ccc3c(c2)COB3O)cc1C |
| InChI | InChI=1S/C17H16BFO5/c1-3-22-17(20)13-8-15(19)16(6-10(13)2)24-12-4-5-14-11(7-12)9-23-18(14)21/h4-8,21H,3,9H2,1-2H3 |
| InChIKey | DGLDHXMUKVVALG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.12 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|