C22H25BO6 — CID 162221319
ethyl 2-(cyclopentylmethoxy)-4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate (PubChem CID 162221319) has the molecular formula C22H25BO6 and a molecular weight of 396.25 g/mol. Its IUPAC name is ethyl 2-(cyclopentylmethoxy)-4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate.
| Compound Name | ethyl 2-(cyclopentylmethoxy)-4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate |
|---|---|
| PubChem CID | 162221319 |
| Molecular Formula | C22H25BO6 |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | ethyl 2-(cyclopentylmethoxy)-4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate |
| SMILES | CCOC(=O)c1ccc(Oc2ccc3c(c2)COB3O)cc1OCC1CCCC1 |
| InChI | InChI=1S/C22H25BO6/c1-2-26-22(24)19-9-7-18(12-21(19)27-13-15-5-3-4-6-15)29-17-8-10-20-16(11-17)14-28-23(20)25/h7-12,15,25H,2-6,13-14H2,1H3 |
| InChIKey | OIXADQZMNUKMIO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|