C16H17BO2S — CID 58404165
1-hydroxy-6-(4-propan-2-ylphenyl)sulfanyl-3H-2,1-benzoxaborole (PubChem CID 58404165) has the molecular formula C16H17BO2S and a molecular weight of 284.19 g/mol. Its IUPAC name is 1-hydroxy-6-(4-propan-2-ylphenyl)sulfanyl-3H-2,1-benzoxaborole.
| Compound Name | 1-hydroxy-6-(4-propan-2-ylphenyl)sulfanyl-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 58404165 |
| Molecular Formula | C16H17BO2S |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-hydroxy-6-(4-propan-2-ylphenyl)sulfanyl-3H-2,1-benzoxaborole |
| SMILES | CC(C)c1ccc(Sc2ccc3c(c2)B(O)OC3)cc1 |
| InChI | InChI=1S/C16H17BO2S/c1-11(2)12-3-6-14(7-4-12)20-15-8-5-13-10-19-17(18)16(13)9-15/h3-9,11,18H,10H2,1-2H3 |
| InChIKey | LHGWACMTVCZSTG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|