C14H12BClO3 — CID 162648491
(3-chlorophenyl)-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanol (PubChem CID 162648491) has the molecular formula C14H12BClO3 and a molecular weight of 274.51 g/mol. Its IUPAC name is (3-chlorophenyl)-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanol.
| Compound Name | (3-chlorophenyl)-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanol |
|---|---|
| PubChem CID | 162648491 |
| Molecular Formula | C14H12BClO3 |
| Molecular Weight | 274.51 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | (3-chlorophenyl)-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanol |
| SMILES | OB1OCc2ccc(C(O)c3cccc(Cl)c3)cc21 |
| InChI | InChI=1S/C14H12BClO3/c16-12-3-1-2-9(6-12)14(17)10-4-5-11-8-19-15(18)13(11)7-10/h1-7,14,17-18H,8H2 |
| InChIKey | LBGWVOGYSUZRIT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.51 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|