C19H15ClO — CID 91678718
(3-chlorophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanol (PubChem CID 91678718) has the molecular formula C19H15ClO and a molecular weight of 294.78 g/mol. Its IUPAC name is (3-chlorophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanol.
| Compound Name | (3-chlorophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanol |
|---|---|
| PubChem CID | 91678718 |
| Molecular Formula | C19H15ClO |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (3-chlorophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanol |
| SMILES | OC(c1cccc(Cl)c1)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C19H15ClO/c20-15-5-1-4-14(11-15)19(21)17-10-9-13-8-7-12-3-2-6-16(17)18(12)13/h1-6,9-11,19,21H,7-8H2 |
| InChIKey | RRDOLZVFJSYPQM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |