C19H14ClI — CID 114939607
5-[chloro-(3-iodophenyl)methyl]-1,2-dihydroacenaphthylene (PubChem CID 114939607) has the molecular formula C19H14ClI and a molecular weight of 404.68 g/mol. Its IUPAC name is 5-[chloro-(3-iodophenyl)methyl]-1,2-dihydroacenaphthylene.
| Compound Name | 5-[chloro-(3-iodophenyl)methyl]-1,2-dihydroacenaphthylene |
|---|---|
| PubChem CID | 114939607 |
| Molecular Formula | C19H14ClI |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | 5-[chloro-(3-iodophenyl)methyl]-1,2-dihydroacenaphthylene |
| SMILES | ClC(c1cccc(I)c1)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C19H14ClI/c20-19(14-4-1-5-15(21)11-14)17-10-9-13-8-7-12-3-2-6-16(17)18(12)13/h1-6,9-11,19H,7-8H2 |
| InChIKey | HRZIREOLEFIGOX-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|