C20H21Cl — CID 114939601
5-[7-bicyclo[4.1.0]heptanyl(chloro)methyl]-1,2-dihydroacenaphthylene (PubChem CID 114939601) has the molecular formula C20H21Cl and a molecular weight of 296.84 g/mol. Its IUPAC name is 5-[7-bicyclo[4.1.0]heptanyl(chloro)methyl]-1,2-dihydroacenaphthylene.
| Compound Name | 5-[7-bicyclo[4.1.0]heptanyl(chloro)methyl]-1,2-dihydroacenaphthylene |
|---|---|
| PubChem CID | 114939601 |
| Molecular Formula | C20H21Cl |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 5-[7-bicyclo[4.1.0]heptanyl(chloro)methyl]-1,2-dihydroacenaphthylene |
| SMILES | ClC(c1ccc2c3c(cccc13)CC2)C1C2CCCCC21 |
| InChI | InChI=1S/C20H21Cl/c21-20(19-14-5-1-2-6-15(14)19)17-11-10-13-9-8-12-4-3-7-16(17)18(12)13/h3-4,7,10-11,14-15,19-20H,1-2,5-6,8-9H2 |
| InChIKey | WLLBIKKSLRWNDF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|