C19H15ClO — CID 99707210
(R)-(2-chlorophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanol (PubChem CID 99707210) has the molecular formula C19H15ClO and a molecular weight of 294.78 g/mol. Its IUPAC name is (R)-(2-chlorophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanol.
| Compound Name | (R)-(2-chlorophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanol |
|---|---|
| PubChem CID | 99707210 |
| Molecular Formula | C19H15ClO |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (R)-(2-chlorophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanol |
| SMILES | O[C@@H](c1ccccc1Cl)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C19H15ClO/c20-17-7-2-1-5-16(17)19(21)15-11-10-13-9-8-12-4-3-6-14(15)18(12)13/h1-7,10-11,19,21H,8-9H2/t19-/m1/s1 |
| InChIKey | XYWHWBKFGSQNKT-LJQANCHMSA-N |
| XLogP | 4.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |