C17H13BrO2 — CID 114939575
(5-bromofuran-2-yl)-(1,2-dihydroacenaphthylen-5-yl)methanol (PubChem CID 114939575) has the molecular formula C17H13BrO2 and a molecular weight of 329.19 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-(1,2-dihydroacenaphthylen-5-yl)methanol.
| Compound Name | (5-bromofuran-2-yl)-(1,2-dihydroacenaphthylen-5-yl)methanol |
|---|---|
| PubChem CID | 114939575 |
| Molecular Formula | C17H13BrO2 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | (5-bromofuran-2-yl)-(1,2-dihydroacenaphthylen-5-yl)methanol |
| SMILES | OC(c1ccc(Br)o1)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C17H13BrO2/c18-15-9-8-14(20-15)17(19)13-7-6-11-5-4-10-2-1-3-12(13)16(10)11/h1-3,6-9,17,19H,4-5H2 |
| InChIKey | UHIJTVFDCGBBDC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |