C14H10Br2ClI — CID 81472849
1,4-dibromo-2-[chloro-(3-iodophenyl)methyl]-5-methylbenzene (PubChem CID 81472849) has the molecular formula C14H10Br2ClI and a molecular weight of 500.40 g/mol. Its IUPAC name is 1,4-dibromo-2-[chloro-(3-iodophenyl)methyl]-5-methylbenzene.
| Compound Name | 1,4-dibromo-2-[chloro-(3-iodophenyl)methyl]-5-methylbenzene |
|---|---|
| PubChem CID | 81472849 |
| Molecular Formula | C14H10Br2ClI |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 497.79 |
| IUPAC Name | 1,4-dibromo-2-[chloro-(3-iodophenyl)methyl]-5-methylbenzene |
| SMILES | Cc1cc(Br)c(C(Cl)c2cccc(I)c2)cc1Br |
| InChI | InChI=1S/C14H10Br2ClI/c1-8-5-13(16)11(7-12(8)15)14(17)9-3-2-4-10(18)6-9/h2-7,14H,1H3 |
| InChIKey | MGHUZZMDGMLELF-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|