C15H13Br2ClO2S — CID 81474086
1,4-dibromo-2-[chloro-(3-methylsulfonylphenyl)methyl]-5-methylbenzene (PubChem CID 81474086) has the molecular formula C15H13Br2ClO2S and a molecular weight of 452.60 g/mol. Its IUPAC name is 1,4-dibromo-2-[chloro-(3-methylsulfonylphenyl)methyl]-5-methylbenzene.
| Compound Name | 1,4-dibromo-2-[chloro-(3-methylsulfonylphenyl)methyl]-5-methylbenzene |
|---|---|
| PubChem CID | 81474086 |
| Molecular Formula | C15H13Br2ClO2S |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 449.87 |
| IUPAC Name | 1,4-dibromo-2-[chloro-(3-methylsulfonylphenyl)methyl]-5-methylbenzene |
| SMILES | Cc1cc(Br)c(C(Cl)c2cccc(S(C)(=O)=O)c2)cc1Br |
| InChI | InChI=1S/C15H13Br2ClO2S/c1-9-6-14(17)12(8-13(9)16)15(18)10-4-3-5-11(7-10)21(2,19)20/h3-8,15H,1-2H3 |
| InChIKey | JFXIYIHHXWKCNL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|