C12H9Br2ClO2S2 — CID 61085021
2,5-dibromo-3-[chloro-(3-methylsulfonylphenyl)methyl]thiophene (PubChem CID 61085021) has the molecular formula C12H9Br2ClO2S2 and a molecular weight of 444.60 g/mol. Its IUPAC name is 2,5-dibromo-3-[chloro-(3-methylsulfonylphenyl)methyl]thiophene.
| Compound Name | 2,5-dibromo-3-[chloro-(3-methylsulfonylphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 61085021 |
| Molecular Formula | C12H9Br2ClO2S2 |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 441.81 |
| IUPAC Name | 2,5-dibromo-3-[chloro-(3-methylsulfonylphenyl)methyl]thiophene |
| SMILES | CS(=O)(=O)c1cccc(C(Cl)c2cc(Br)sc2Br)c1 |
| InChI | InChI=1S/C12H9Br2ClO2S2/c1-19(16,17)8-4-2-3-7(5-8)11(15)9-6-10(13)18-12(9)14/h2-6,11H,1H3 |
| InChIKey | HFKSHBGXDGKHCN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|