C16H17BFNO5S — CID 58344077
2-[5-amino-2-[(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]phenyl]ethanol (PubChem CID 58344077) has the molecular formula C16H17BFNO5S and a molecular weight of 365.19 g/mol. Its IUPAC name is 2-[5-amino-2-[(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]phenyl]ethanol.
| Compound Name | 2-[5-amino-2-[(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]phenyl]ethanol |
|---|---|
| PubChem CID | 58344077 |
| Molecular Formula | C16H17BFNO5S |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-[5-amino-2-[(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]phenyl]ethanol |
| SMILES | Nc1ccc(S(=O)(=O)Cc2cc3c(cc2F)COB3O)c(CCO)c1 |
| InChI | InChI=1S/C16H17BFNO5S/c18-15-7-11-8-24-17(21)14(11)6-12(15)9-25(22,23)16-2-1-13(19)5-10(16)3-4-20/h1-2,5-7,20-21H,3-4,8-9,19H2 |
| InChIKey | BIFYCKHRIBCABG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|