C13H9BF2N2O6S — CID 67174946
2-fluoro-N-(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-nitrobenzenesulfonamide (PubChem CID 67174946) has the molecular formula C13H9BF2N2O6S and a molecular weight of 370.10 g/mol. Its IUPAC name is 2-fluoro-N-(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-nitrobenzenesulfonamide.
| Compound Name | 2-fluoro-N-(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67174946 |
| Molecular Formula | C13H9BF2N2O6S |
| Molecular Weight | 370.10 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 2-fluoro-N-(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Nc2cc3c(cc2F)COB3O)c(F)c1 |
| InChI | InChI=1S/C13H9BF2N2O6S/c15-10-3-7-6-24-14(19)9(7)5-12(10)17-25(22,23)13-2-1-8(18(20)21)4-11(13)16/h1-5,17,19H,6H2 |
| InChIKey | UJBMEVWPHLQYES-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.10 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|