C11H15FN2O5S — CID 115362999
2-fluoro-N-(3-hydroxy-2,2-dimethylpropyl)-4-nitrobenzenesulfonamide (PubChem CID 115362999) has the molecular formula C11H15FN2O5S and a molecular weight of 306.31 g/mol. Its IUPAC name is 2-fluoro-N-(3-hydroxy-2,2-dimethylpropyl)-4-nitrobenzenesulfonamide.
| Compound Name | 2-fluoro-N-(3-hydroxy-2,2-dimethylpropyl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115362999 |
| Molecular Formula | C11H15FN2O5S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-fluoro-N-(3-hydroxy-2,2-dimethylpropyl)-4-nitrobenzenesulfonamide |
| SMILES | CC(C)(CO)CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C11H15FN2O5S/c1-11(2,7-15)6-13-20(18,19)10-4-3-8(14(16)17)5-9(10)12/h3-5,13,15H,6-7H2,1-2H3 |
| InChIKey | JEYOXLUFBDXIBM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|