C10H12F2N2O6S — CID 66170537
N-(2,3-dihydroxy-2-methylpropyl)-2,4-difluoro-5-nitrobenzenesulfonamide (PubChem CID 66170537) has the molecular formula C10H12F2N2O6S and a molecular weight of 326.28 g/mol. Its IUPAC name is N-(2,3-dihydroxy-2-methylpropyl)-2,4-difluoro-5-nitrobenzenesulfonamide.
| Compound Name | N-(2,3-dihydroxy-2-methylpropyl)-2,4-difluoro-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 66170537 |
| Molecular Formula | C10H12F2N2O6S |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N-(2,3-dihydroxy-2-methylpropyl)-2,4-difluoro-5-nitrobenzenesulfonamide |
| SMILES | CC(O)(CO)CNS(=O)(=O)c1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C10H12F2N2O6S/c1-10(16,5-15)4-13-21(19,20)9-3-8(14(17)18)6(11)2-7(9)12/h2-3,13,15-16H,4-5H2,1H3 |
| InChIKey | PLSXKGYAIJLICB-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|