C12H12F2N2O4S — CID 106210011
2,4-difluoro-N-hex-5-ynyl-5-nitrobenzenesulfonamide (PubChem CID 106210011) has the molecular formula C12H12F2N2O4S and a molecular weight of 318.30 g/mol. Its IUPAC name is 2,4-difluoro-N-hex-5-ynyl-5-nitrobenzenesulfonamide.
| Compound Name | 2,4-difluoro-N-hex-5-ynyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 106210011 |
| Molecular Formula | C12H12F2N2O4S |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2,4-difluoro-N-hex-5-ynyl-5-nitrobenzenesulfonamide |
| SMILES | C#CCCCCNS(=O)(=O)c1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C12H12F2N2O4S/c1-2-3-4-5-6-15-21(19,20)12-8-11(16(17)18)9(13)7-10(12)14/h1,7-8,15H,3-6H2 |
| InChIKey | HJYHIJQLGQLEPJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|