C15H12BClFNO3S — CID 147228040
O-[(4-fluorophenyl)methyl] N-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamothioate (PubChem CID 147228040) has the molecular formula C15H12BClFNO3S and a molecular weight of 351.60 g/mol. Its IUPAC name is O-[(4-fluorophenyl)methyl] N-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamothioate.
| Compound Name | O-[(4-fluorophenyl)methyl] N-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamothioate |
|---|---|
| PubChem CID | 147228040 |
| Molecular Formula | C15H12BClFNO3S |
| Molecular Weight | 351.60 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | O-[(4-fluorophenyl)methyl] N-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamothioate |
| SMILES | OB1OCc2cc(Cl)c(NC(=S)OCc3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C15H12BClFNO3S/c17-13-5-10-8-22-16(20)12(10)6-14(13)19-15(23)21-7-9-1-3-11(18)4-2-9/h1-6,20H,7-8H2,(H,19,23) |
| InChIKey | CIIXWYNWGPNOFW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.60 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|