C24H25BFNO4S — CID 154606067
O-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl]phenyl]methyl] N-(4-fluorophenyl)carbamothioate (PubChem CID 154606067) has the molecular formula C24H25BFNO4S and a molecular weight of 453.34 g/mol. Its IUPAC name is O-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl]phenyl]methyl] N-(4-fluorophenyl)carbamothioate.
| Compound Name | O-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl]phenyl]methyl] N-(4-fluorophenyl)carbamothioate |
|---|---|
| PubChem CID | 154606067 |
| Molecular Formula | C24H25BFNO4S |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | O-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl]phenyl]methyl] N-(4-fluorophenyl)carbamothioate |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(COC(=S)Nc4ccc(F)cc4)cc3)o2)OC1(C)C |
| InChI | InChI=1S/C24H25BFNO4S/c1-23(2)24(3,4)31-25(30-23)21-14-13-20(29-21)17-7-5-16(6-8-17)15-28-22(32)27-19-11-9-18(26)10-12-19/h5-14H,15H2,1-4H3,(H,27,32) |
| InChIKey | BCJBCRGGXAFHNW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|