C22H24FNO2 — CID 55738362
N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-[4-(propan-2-yloxymethyl)phenyl]methanamine (PubChem CID 55738362) has the molecular formula C22H24FNO2 and a molecular weight of 353.44 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-[4-(propan-2-yloxymethyl)phenyl]methanamine.
| Compound Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-[4-(propan-2-yloxymethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 55738362 |
| Molecular Formula | C22H24FNO2 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-[4-(propan-2-yloxymethyl)phenyl]methanamine |
| SMILES | CC(C)OCc1ccc(CNCc2ccc(-c3ccc(F)cc3)o2)cc1 |
| InChI | InChI=1S/C22H24FNO2/c1-16(2)25-15-18-5-3-17(4-6-18)13-24-14-21-11-12-22(26-21)19-7-9-20(23)10-8-19/h3-12,16,24H,13-15H2,1-2H3 |
| InChIKey | KDUQXIZHSVKSHD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |