C19H15F4NO — CID 55387081
N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-[3-(trifluoromethyl)phenyl]methanamine (PubChem CID 55387081) has the molecular formula C19H15F4NO and a molecular weight of 349.33 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-[3-(trifluoromethyl)phenyl]methanamine.
| Compound Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-[3-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 55387081 |
| Molecular Formula | C19H15F4NO |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-[3-(trifluoromethyl)phenyl]methanamine |
| SMILES | Fc1ccc(-c2ccc(CNCc3cccc(C(F)(F)F)c3)o2)cc1 |
| InChI | InChI=1S/C19H15F4NO/c20-16-6-4-14(5-7-16)18-9-8-17(25-18)12-24-11-13-2-1-3-15(10-13)19(21,22)23/h1-10,24H,11-12H2 |
| InChIKey | FXMLPAYXKCMWQG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |