C15H12ClF4N — CID 115656673
N-[(3-chloro-2-fluorophenyl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine (PubChem CID 115656673) has the molecular formula C15H12ClF4N and a molecular weight of 317.71 g/mol. Its IUPAC name is N-[(3-chloro-2-fluorophenyl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine.
| Compound Name | N-[(3-chloro-2-fluorophenyl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 115656673 |
| Molecular Formula | C15H12ClF4N |
| Molecular Weight | 317.71 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-[(3-chloro-2-fluorophenyl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine |
| SMILES | Fc1c(Cl)cccc1CNCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12ClF4N/c16-13-6-2-4-11(14(13)17)9-21-8-10-3-1-5-12(7-10)15(18,19)20/h1-7,21H,8-9H2 |
| InChIKey | QMHYCNUDNBZCAV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.71 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |