C15H14ClF2N — CID 65024863
1-[3-(chloromethyl)phenyl]-N-[(2,3-difluorophenyl)methyl]methanamine (PubChem CID 65024863) has the molecular formula C15H14ClF2N and a molecular weight of 281.73 g/mol. Its IUPAC name is 1-[3-(chloromethyl)phenyl]-N-[(2,3-difluorophenyl)methyl]methanamine.
| Compound Name | 1-[3-(chloromethyl)phenyl]-N-[(2,3-difluorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 65024863 |
| Molecular Formula | C15H14ClF2N |
| Molecular Weight | 281.73 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-[3-(chloromethyl)phenyl]-N-[(2,3-difluorophenyl)methyl]methanamine |
| SMILES | Fc1cccc(CNCc2cccc(CCl)c2)c1F |
| InChI | InChI=1S/C15H14ClF2N/c16-8-11-3-1-4-12(7-11)9-19-10-13-5-2-6-14(17)15(13)18/h1-7,19H,8-10H2 |
| InChIKey | BAOGAUFJDIDOBD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.73 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|