C19H24FNO — CID 119107414
N-[(2-fluorophenyl)methyl]-1-[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methanamine (PubChem CID 119107414) has the molecular formula C19H24FNO and a molecular weight of 301.40 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-1-[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methanamine.
| Compound Name | N-[(2-fluorophenyl)methyl]-1-[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methanamine |
|---|---|
| PubChem CID | 119107414 |
| Molecular Formula | C19H24FNO |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-1-[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methanamine |
| SMILES | CC(C)(C)OCc1cccc(CNCc2ccccc2F)c1 |
| InChI | InChI=1S/C19H24FNO/c1-19(2,3)22-14-16-8-6-7-15(11-16)12-21-13-17-9-4-5-10-18(17)20/h4-11,21H,12-14H2,1-3H3 |
| InChIKey | VCEQUCUKNQCULG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |