C19H22F3NO — CID 119113222
1-[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]-N-[(3,4,5-trifluorophenyl)methyl]methanamine (PubChem CID 119113222) has the molecular formula C19H22F3NO and a molecular weight of 337.39 g/mol. Its IUPAC name is 1-[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]-N-[(3,4,5-trifluorophenyl)methyl]methanamine.
| Compound Name | 1-[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]-N-[(3,4,5-trifluorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 119113222 |
| Molecular Formula | C19H22F3NO |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]-N-[(3,4,5-trifluorophenyl)methyl]methanamine |
| SMILES | CC(C)(C)OCc1cccc(CNCc2cc(F)c(F)c(F)c2)c1 |
| InChI | InChI=1S/C19H22F3NO/c1-19(2,3)24-12-14-6-4-5-13(7-14)10-23-11-15-8-16(20)18(22)17(21)9-15/h4-9,23H,10-12H2,1-3H3 |
| InChIKey | DTQFDXHDPSACEW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|