C21H28F2IN3O — CID 111902882
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111902882) has the molecular formula C21H28F2IN3O and a molecular weight of 503.38 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111902882 |
| Molecular Formula | C21H28F2IN3O |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(COC(C)(C)C)c1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C21H27F2N3O.HI/c1-21(2,3)27-14-16-7-5-6-15(10-16)12-25-20(24-4)26-13-17-11-18(22)8-9-19(17)23;/h5-11H,12-14H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | CGKSODQONRMUIA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|