C13H13F3N2 — CID 55021234
N-(1H-pyrrol-2-ylmethyl)-1-[3-(trifluoromethyl)phenyl]methanamine (PubChem CID 55021234) has the molecular formula C13H13F3N2 and a molecular weight of 254.26 g/mol. Its IUPAC name is N-(1H-pyrrol-2-ylmethyl)-1-[3-(trifluoromethyl)phenyl]methanamine.
| Compound Name | N-(1H-pyrrol-2-ylmethyl)-1-[3-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 55021234 |
| Molecular Formula | C13H13F3N2 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | N-(1H-pyrrol-2-ylmethyl)-1-[3-(trifluoromethyl)phenyl]methanamine |
| SMILES | FC(F)(F)c1cccc(CNCc2ccc[nH]2)c1 |
| InChI | InChI=1S/C13H13F3N2/c14-13(15,16)11-4-1-3-10(7-11)8-17-9-12-5-2-6-18-12/h1-7,17-18H,8-9H2 |
| InChIKey | NHYHLGSELNDUII-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |