C12H15BClNO4 — CID 140761779
5-chloro-1-hydroxy-N-(1-hydroxybutan-2-yl)-3H-2,1-benzoxaborole-6-carboxamide (PubChem CID 140761779) has the molecular formula C12H15BClNO4 and a molecular weight of 283.52 g/mol. Its IUPAC name is 5-chloro-1-hydroxy-N-(1-hydroxybutan-2-yl)-3H-2,1-benzoxaborole-6-carboxamide.
| Compound Name | 5-chloro-1-hydroxy-N-(1-hydroxybutan-2-yl)-3H-2,1-benzoxaborole-6-carboxamide |
|---|---|
| PubChem CID | 140761779 |
| Molecular Formula | C12H15BClNO4 |
| Molecular Weight | 283.52 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 5-chloro-1-hydroxy-N-(1-hydroxybutan-2-yl)-3H-2,1-benzoxaborole-6-carboxamide |
| SMILES | CCC(CO)NC(=O)c1cc2c(cc1Cl)COB2O |
| InChI | InChI=1S/C12H15BClNO4/c1-2-8(5-16)15-12(17)9-4-10-7(3-11(9)14)6-19-13(10)18/h3-4,8,16,18H,2,5-6H2,1H3,(H,15,17) |
| InChIKey | PWWQAZYWBQNLQR-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.52 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|