C15H22N2O2S2 — CID 118643367
O-propyl N-[2-methyl-5-(propoxycarbothioylamino)phenyl]carbamothioate (PubChem CID 118643367) has the molecular formula C15H22N2O2S2 and a molecular weight of 326.49 g/mol. Its IUPAC name is O-propyl N-[2-methyl-5-(propoxycarbothioylamino)phenyl]carbamothioate.
| Compound Name | O-propyl N-[2-methyl-5-(propoxycarbothioylamino)phenyl]carbamothioate |
|---|---|
| PubChem CID | 118643367 |
| Molecular Formula | C15H22N2O2S2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | O-propyl N-[2-methyl-5-(propoxycarbothioylamino)phenyl]carbamothioate |
| SMILES | CCCOC(=S)Nc1ccc(C)c(NC(=S)OCCC)c1 |
| InChI | InChI=1S/C15H22N2O2S2/c1-4-8-18-14(20)16-12-7-6-11(3)13(10-12)17-15(21)19-9-5-2/h6-7,10H,4-5,8-9H2,1-3H3,(H,16,20)(H,17,21) |
| InChIKey | VDZUTLQYBMEBSF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|