C18H15BClF5N2O4S — CID 86304691
N-[1-[(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-cyanopropan-2-yl]-4-(pentafluoro-λ6-sulfanyl)benzamide (PubChem CID 86304691) has the molecular formula C18H15BClF5N2O4S and a molecular weight of 496.65 g/mol. Its IUPAC name is N-[1-[(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-cyanopropan-2-yl]-4-(pentafluoro-λ6-sulfanyl)benzamide.
| Compound Name | N-[1-[(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-cyanopropan-2-yl]-4-(pentafluoro-λ6-sulfanyl)benzamide |
|---|---|
| PubChem CID | 86304691 |
| Molecular Formula | C18H15BClF5N2O4S |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | N-[1-[(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-cyanopropan-2-yl]-4-(pentafluoro-λ6-sulfanyl)benzamide |
| SMILES | CC(C#N)(COc1ccc2c(c1Cl)B(O)OC2)NC(=O)c1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15BClF5N2O4S/c1-18(9-26,10-30-14-7-4-12-8-31-19(29)15(12)16(14)20)27-17(28)11-2-5-13(6-3-11)32(21,22,23,24)25/h2-7,29H,8,10H2,1H3,(H,27,28) |
| InChIKey | MKPYLXNCKPVYIV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|