C12H12BF3N2O3 — CID 154066075
2-amino-3-[[1-hydroxy-7-(trifluoromethyl)-3H-2,1-benzoxaborol-6-yl]oxy]-2-methylpropanenitrile (PubChem CID 154066075) has the molecular formula C12H12BF3N2O3 and a molecular weight of 300.05 g/mol. Its IUPAC name is 2-amino-3-[[1-hydroxy-7-(trifluoromethyl)-3H-2,1-benzoxaborol-6-yl]oxy]-2-methylpropanenitrile.
| Compound Name | 2-amino-3-[[1-hydroxy-7-(trifluoromethyl)-3H-2,1-benzoxaborol-6-yl]oxy]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 154066075 |
| Molecular Formula | C12H12BF3N2O3 |
| Molecular Weight | 300.05 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-amino-3-[[1-hydroxy-7-(trifluoromethyl)-3H-2,1-benzoxaborol-6-yl]oxy]-2-methylpropanenitrile |
| SMILES | CC(N)(C#N)COc1ccc2c(c1C(F)(F)F)B(O)OC2 |
| InChI | InChI=1S/C12H12BF3N2O3/c1-11(18,5-17)6-20-8-3-2-7-4-21-13(19)10(7)9(8)12(14,15)16/h2-3,19H,4,6,18H2,1H3 |
| InChIKey | RJEYDOGTBOLJNS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.05 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|