C19H15BF3N3O7 — CID 124672602
N-[(2S)-2-cyano-1-[(1-hydroxy-7-nitro-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-yl]-4-(trifluoromethoxy)benzamide (PubChem CID 124672602) has the molecular formula C19H15BF3N3O7 and a molecular weight of 465.15 g/mol. Its IUPAC name is N-[(2S)-2-cyano-1-[(1-hydroxy-7-nitro-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-yl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[(2S)-2-cyano-1-[(1-hydroxy-7-nitro-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-yl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 124672602 |
| Molecular Formula | C19H15BF3N3O7 |
| Molecular Weight | 465.15 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | N-[(2S)-2-cyano-1-[(1-hydroxy-7-nitro-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-yl]-4-(trifluoromethoxy)benzamide |
| SMILES | C[C@](C#N)(COc1ccc2c(c1[N+](=O)[O-])B(O)OC2)NC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15BF3N3O7/c1-18(9-24,25-17(27)11-2-5-13(6-3-11)33-19(21,22)23)10-31-14-7-4-12-8-32-20(28)15(12)16(14)26(29)30/h2-7,28H,8,10H2,1H3,(H,25,27)/t18-/m0/s1 |
| InChIKey | YHUHLJNRJYSCFE-SFHVURJKSA-N |
| XLogP | 1.80 |
| TPSA | 143.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.15 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|