C18H13ClF4N2O3 — CID 24808425
N-[1-(2-chloro-5-fluorophenoxy)-2-cyanopropan-2-yl]-4-(trifluoromethoxy)benzamide (PubChem CID 24808425) has the molecular formula C18H13ClF4N2O3 and a molecular weight of 416.76 g/mol. Its IUPAC name is N-[1-(2-chloro-5-fluorophenoxy)-2-cyanopropan-2-yl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[1-(2-chloro-5-fluorophenoxy)-2-cyanopropan-2-yl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 24808425 |
| Molecular Formula | C18H13ClF4N2O3 |
| Molecular Weight | 416.76 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | N-[1-(2-chloro-5-fluorophenoxy)-2-cyanopropan-2-yl]-4-(trifluoromethoxy)benzamide |
| SMILES | CC(C#N)(COc1cc(F)ccc1Cl)NC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H13ClF4N2O3/c1-17(9-24,10-27-15-8-12(20)4-7-14(15)19)25-16(26)11-2-5-13(6-3-11)28-18(21,22)23/h2-8H,10H2,1H3,(H,25,26) |
| InChIKey | FRLXTOYZLVOKTI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.76 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |