C25H20BF3N2O5 — CID 86304856
N-[2-cyano-1-[(1-hydroxy-7-phenyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-yl]-4-(trifluoromethoxy)benzamide (PubChem CID 86304856) has the molecular formula C25H20BF3N2O5 and a molecular weight of 496.25 g/mol. Its IUPAC name is N-[2-cyano-1-[(1-hydroxy-7-phenyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-yl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[2-cyano-1-[(1-hydroxy-7-phenyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-yl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 86304856 |
| Molecular Formula | C25H20BF3N2O5 |
| Molecular Weight | 496.25 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | N-[2-cyano-1-[(1-hydroxy-7-phenyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-yl]-4-(trifluoromethoxy)benzamide |
| SMILES | CC(C#N)(COc1ccc2c(c1-c1ccccc1)B(O)OC2)NC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H20BF3N2O5/c1-24(14-30,31-23(32)17-7-10-19(11-8-17)36-25(27,28)29)15-34-20-12-9-18-13-35-26(33)22(18)21(20)16-5-3-2-4-6-16/h2-12,33H,13,15H2,1H3,(H,31,32) |
| InChIKey | OONJIRYLEZIKJF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|