C20H18BF3N2O5 — CID 90461993
N-[2-cyano-1-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-yl]-2-(trifluoromethoxy)benzamide (PubChem CID 90461993) has the molecular formula C20H18BF3N2O5 and a molecular weight of 434.18 g/mol. Its IUPAC name is N-[2-cyano-1-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-yl]-2-(trifluoromethoxy)benzamide.
| Compound Name | N-[2-cyano-1-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-yl]-2-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 90461993 |
| Molecular Formula | C20H18BF3N2O5 |
| Molecular Weight | 434.18 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-[2-cyano-1-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-yl]-2-(trifluoromethoxy)benzamide |
| SMILES | Cc1c(OCC(C)(C#N)NC(=O)c2ccccc2OC(F)(F)F)ccc2c1B(O)OC2 |
| InChI | InChI=1S/C20H18BF3N2O5/c1-12-15(8-7-13-9-30-21(28)17(12)13)29-11-19(2,10-25)26-18(27)14-5-3-4-6-16(14)31-20(22,23)24/h3-8,28H,9,11H2,1-2H3,(H,26,27) |
| InChIKey | NZIBFLLYPNVARS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.18 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|