C13H13F3N2O3 — CID 75497344
N-(2-cyano-1-methoxypropan-2-yl)-2-(trifluoromethoxy)benzamide (PubChem CID 75497344) has the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. Its IUPAC name is N-(2-cyano-1-methoxypropan-2-yl)-2-(trifluoromethoxy)benzamide.
| Compound Name | N-(2-cyano-1-methoxypropan-2-yl)-2-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 75497344 |
| Molecular Formula | C13H13F3N2O3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-(2-cyano-1-methoxypropan-2-yl)-2-(trifluoromethoxy)benzamide |
| SMILES | COCC(C)(C#N)NC(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O3/c1-12(7-17,8-20-2)18-11(19)9-5-3-4-6-10(9)21-13(14,15)16/h3-6H,8H2,1-2H3,(H,18,19) |
| InChIKey | OZOIBSYDYHYMKH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |