C14H19BN2O3 — CID 90458531
2-amino-3-[(1-hydroxy-7-propan-2-yl-3H-2,1-benzoxaborol-6-yl)oxy]-2-methylpropanenitrile (PubChem CID 90458531) has the molecular formula C14H19BN2O3 and a molecular weight of 274.13 g/mol. Its IUPAC name is 2-amino-3-[(1-hydroxy-7-propan-2-yl-3H-2,1-benzoxaborol-6-yl)oxy]-2-methylpropanenitrile.
| Compound Name | 2-amino-3-[(1-hydroxy-7-propan-2-yl-3H-2,1-benzoxaborol-6-yl)oxy]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 90458531 |
| Molecular Formula | C14H19BN2O3 |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2-amino-3-[(1-hydroxy-7-propan-2-yl-3H-2,1-benzoxaborol-6-yl)oxy]-2-methylpropanenitrile |
| SMILES | CC(C)c1c(OCC(C)(N)C#N)ccc2c1B(O)OC2 |
| InChI | InChI=1S/C14H19BN2O3/c1-9(2)12-11(19-8-14(3,17)7-16)5-4-10-6-20-15(18)13(10)12/h4-5,9,18H,6,8,17H2,1-3H3 |
| InChIKey | UHTJLVSEVWSUAR-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|