C12H16BFO5 — CID 145362817
ethane;methyl 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate (PubChem CID 145362817) has the molecular formula C12H16BFO5 and a molecular weight of 270.06 g/mol. Its IUPAC name is ethane;methyl 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate.
| Compound Name | ethane;methyl 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate |
|---|---|
| PubChem CID | 145362817 |
| Molecular Formula | C12H16BFO5 |
| Molecular Weight | 270.06 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | ethane;methyl 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate |
| SMILES | CC.COC(=O)COc1ccc2c(c1F)B(O)OC2 |
| InChI | InChI=1S/C10H10BFO5.C2H6/c1-15-8(13)5-16-7-3-2-6-4-17-11(14)9(6)10(7)12;1-2/h2-3,14H,4-5H2,1H3;1-2H3 |
| InChIKey | CBVUUCWAIMDKSY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.06 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|